C21H15NO5S — CID 168518780
phenyl 5-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonate (PubChem CID 168518780) has the molecular formula C21H15NO5S and a molecular weight of 393.42 g/mol. Its IUPAC name is phenyl 5-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonate.
| Compound Name | phenyl 5-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168518780 |
| Molecular Formula | C21H15NO5S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | phenyl 5-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonate |
| SMILES | Cc1ccc(N2C(=O)c3ccccc3C2=O)cc1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C21H15NO5S/c1-14-11-12-15(22-20(23)17-9-5-6-10-18(17)21(22)24)13-19(14)28(25,26)27-16-7-3-2-4-8-16/h2-13H,1H3 |
| InChIKey | GANBERPDHCQTOJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|