C15H11NO5S — CID 168511809
4-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonic acid (PubChem CID 168511809) has the molecular formula C15H11NO5S and a molecular weight of 317.32 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonic acid.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 168511809 |
| Molecular Formula | C15H11NO5S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2-methylbenzenesulfonic acid |
| SMILES | Cc1cc(N2C(=O)c3ccccc3C2=O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H11NO5S/c1-9-8-10(6-7-13(9)22(19,20)21)16-14(17)11-4-2-3-5-12(11)15(16)18/h2-8H,1H3,(H,19,20,21) |
| InChIKey | ONSWMZHIWRCLDF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|