3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid

C14H9NO5S — CID 168515939

IUPAC3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid
SMILESO=C1c2ccccc2C(=O)N1c1cccc(S(=O)(=O)O)c1
InChIInChI=1S/C14H9NO5S/c16-13-11-6-1-2-7-12(11)14(17)15(13)9-4-3-5-10(8-9)21(18,19)20/h1-8H,(H,18,19,20)
InChIKeyCXKLWWUKXRNIHJ-UHFFFAOYSA-N
MW303.30 g/mol
LogP1.73
Rot. Bonds2

About 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid

3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid (PubChem CID 168515939) has the molecular formula C14H9NO5S and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid.

Molecular Properties

Compound Name3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid
PubChem CID168515939
Molecular FormulaC14H9NO5S
Molecular Weight303.30 g/mol
Exact Mass303.02
IUPAC Name3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid
SMILESO=C1c2ccccc2C(=O)N1c1cccc(S(=O)(=O)O)c1
InChIInChI=1S/C14H9NO5S/c16-13-11-6-1-2-7-12(11)14(17)15(13)9-4-3-5-10(8-9)21(18,19)20/h1-8H,(H,18,19,20)
InChIKeyCXKLWWUKXRNIHJ-UHFFFAOYSA-N
XLogP1.73
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.30
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid?
The IUPAC name of 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid (CID 168515939) is 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid.
What is the SMILES notation for 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid?
The canonical SMILES for 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid is O=C1c2ccccc2C(=O)N1c1cccc(S(=O)(=O)O)c1.
What is the InChIKey of 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid?
The InChIKey is CXKLWWUKXRNIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO5S/c16-13-11-6-1-2-7-12(11)14(17)15(13)9-4-3-5-10(8-9)21(18,19)20/h1-8H,(H,18,19,20).
What are the key properties of 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid?
3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid has a molecular weight of 303.30 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid is sourced from PubChem (CID 168515939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).