C14H9NO5S — CID 168515939
3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid (PubChem CID 168515939) has the molecular formula C14H9NO5S and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 168515939 |
| Molecular Formula | C14H9NO5S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C14H9NO5S/c16-13-11-6-1-2-7-12(11)14(17)15(13)9-4-3-5-10(8-9)21(18,19)20/h1-8H,(H,18,19,20) |
| InChIKey | CXKLWWUKXRNIHJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|