C14H8N2O7S — CID 168519854
4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzenesulfonic acid (PubChem CID 168519854) has the molecular formula C14H8N2O7S and a molecular weight of 348.29 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzenesulfonic acid.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 168519854 |
| Molecular Formula | C14H8N2O7S |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzenesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8N2O7S/c17-13-9-3-1-2-4-10(9)14(18)15(13)8-5-6-12(24(21,22)23)11(7-8)16(19)20/h1-7H,(H,21,22,23) |
| InChIKey | BOJFWSSVJRFBGB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|