C15H9N3O5 — CID 168518775
4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzamide (PubChem CID 168518775) has the molecular formula C15H9N3O5 and a molecular weight of 311.25 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 168518775 |
| Molecular Formula | C15H9N3O5 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2-nitrobenzamide |
| SMILES | NC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H9N3O5/c16-13(19)11-6-5-8(7-12(11)18(22)23)17-14(20)9-3-1-2-4-10(9)15(17)21/h1-7H,(H2,16,19) |
| InChIKey | OQTPRLTWPBYICI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|