C16H12N2O7S — CID 11740232
2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-nitrobenzenesulfonic acid (PubChem CID 11740232) has the molecular formula C16H12N2O7S and a molecular weight of 376.35 g/mol. Its IUPAC name is 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-nitrobenzenesulfonic acid.
| Compound Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 11740232 |
| Molecular Formula | C16H12N2O7S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-nitrobenzenesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1c([N+](=O)[O-])cccc1S(=O)(=O)O |
| InChI | InChI=1S/C16H12N2O7S/c19-15-10-4-1-2-5-11(10)16(20)17(15)9-8-12-13(18(21)22)6-3-7-14(12)26(23,24)25/h1-7H,8-9H2,(H,23,24,25) |
| InChIKey | UCMFDHUZXVOQJG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|