C15H10N2O6S — CID 4155105
1,3-dioxo-2-(3-sulfamoylphenyl)isoindole-5-carboxylic acid (PubChem CID 4155105) has the molecular formula C15H10N2O6S and a molecular weight of 346.32 g/mol. Its IUPAC name is 1,3-dioxo-2-(3-sulfamoylphenyl)isoindole-5-carboxylic acid.
| Compound Name | 1,3-dioxo-2-(3-sulfamoylphenyl)isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 4155105 |
| Molecular Formula | C15H10N2O6S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1,3-dioxo-2-(3-sulfamoylphenyl)isoindole-5-carboxylic acid |
| SMILES | NS(=O)(=O)c1cccc(N2C(=O)c3ccc(C(=O)O)cc3C2=O)c1 |
| InChI | InChI=1S/C15H10N2O6S/c16-24(22,23)10-3-1-2-9(7-10)17-13(18)11-5-4-8(15(20)21)6-12(11)14(17)19/h1-7H,(H,20,21)(H2,16,22,23) |
| InChIKey | VOQSFGMGKDLTOA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|