C21H13NO7S — CID 4124462
4-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid (PubChem CID 4124462) has the molecular formula C21H13NO7S and a molecular weight of 423.40 g/mol. Its IUPAC name is 4-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid.
| Compound Name | 4-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 4124462 |
| Molecular Formula | C21H13NO7S |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 4-[2-(3-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)c2ccc3c(c2)C(=O)N(c2cccc(O)c2)C3=O)cc1 |
| InChI | InChI=1S/C21H13NO7S/c23-14-3-1-2-13(10-14)22-19(24)17-9-8-16(11-18(17)20(22)25)30(28,29)15-6-4-12(5-7-15)21(26)27/h1-11,23H,(H,26,27) |
| InChIKey | CERSYDPSKRVNBN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|