C22H14N2O8S — CID 2867239
4-[2-(3-methyl-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid (PubChem CID 2867239) has the molecular formula C22H14N2O8S and a molecular weight of 466.43 g/mol. Its IUPAC name is 4-[2-(3-methyl-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid.
| Compound Name | 4-[2-(3-methyl-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 2867239 |
| Molecular Formula | C22H14N2O8S |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 4-[2-(3-methyl-4-nitrophenyl)-1,3-dioxoisoindol-5-yl]sulfonylbenzoic acid |
| SMILES | Cc1cc(N2C(=O)c3ccc(S(=O)(=O)c4ccc(C(=O)O)cc4)cc3C2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14N2O8S/c1-12-10-14(4-9-19(12)24(29)30)23-20(25)17-8-7-16(11-18(17)21(23)26)33(31,32)15-5-2-13(3-6-15)22(27)28/h2-11H,1H3,(H,27,28) |
| InChIKey | BWEOZHIJIVKXFD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 151.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|