C20H17NO7S — CID 1202024
4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]sulfonylbenzoic acid (PubChem CID 1202024) has the molecular formula C20H17NO7S and a molecular weight of 415.42 g/mol. Its IUPAC name is 4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]sulfonylbenzoic acid.
| Compound Name | 4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 1202024 |
| Molecular Formula | C20H17NO7S |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-[1,3-dioxo-2-[[(2S)-oxolan-2-yl]methyl]isoindol-5-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)c2ccc3c(c2)C(=O)N(C[C@@H]2CCCO2)C3=O)cc1 |
| InChI | InChI=1S/C20H17NO7S/c22-18-16-8-7-15(29(26,27)14-5-3-12(4-6-14)20(24)25)10-17(16)19(23)21(18)11-13-2-1-9-28-13/h3-8,10,13H,1-2,9,11H2,(H,24,25)/t13-/m0/s1 |
| InChIKey | FXSPDOUCUXSMCG-ZDUSSCGKSA-N |
| XLogP | 1.99 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|