C19H23N3O4 — CID 119378309
5-(3-aminopiperidine-1-carbonyl)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione (PubChem CID 119378309) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-(3-aminopiperidine-1-carbonyl)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-(3-aminopiperidine-1-carbonyl)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 119378309 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 5-(3-aminopiperidine-1-carbonyl)-2-(oxolan-2-ylmethyl)isoindole-1,3-dione |
| SMILES | NC1CCCN(C(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)C1 |
| InChI | InChI=1S/C19H23N3O4/c20-13-3-1-7-21(10-13)17(23)12-5-6-15-16(9-12)19(25)22(18(15)24)11-14-4-2-8-26-14/h5-6,9,13-14H,1-4,7-8,10-11,20H2 |
| InChIKey | PNLTWEYUQIRKEK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|