C21H19F3N4O4 — CID 154833059
2-(oxolan-2-ylmethyl)-5-[3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl]isoindole-1,3-dione (PubChem CID 154833059) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-5-[3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(oxolan-2-ylmethyl)-5-[3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154833059 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-5-[3-(trifluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)N1CCc2[nH]nc(C(F)(F)F)c2C1 |
| InChI | InChI=1S/C21H19F3N4O4/c22-21(23,24)17-15-10-27(6-5-16(15)25-26-17)18(29)11-3-4-13-14(8-11)20(31)28(19(13)30)9-12-2-1-7-32-12/h3-4,8,12H,1-2,5-7,9-10H2,(H,25,26) |
| InChIKey | STQPLPGOFXZVGG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|