C23H30N4O5 — CID 55372681
2-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 55372681) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 55372681 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-[4-[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCN(C(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)CC1 |
| InChI | InChI=1S/C23H30N4O5/c1-2-7-24-20(28)15-25-8-10-26(11-9-25)21(29)16-5-6-18-19(13-16)23(31)27(22(18)30)14-17-4-3-12-32-17/h5-6,13,17H,2-4,7-12,14-15H2,1H3,(H,24,28) |
| InChIKey | LWRNNWZOPSCQFS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|