C24H24N2O4 — CID 55495913
2-(oxolan-2-ylmethyl)-5-(2-phenylpyrrolidine-1-carbonyl)isoindole-1,3-dione (PubChem CID 55495913) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethyl)-5-(2-phenylpyrrolidine-1-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-(oxolan-2-ylmethyl)-5-(2-phenylpyrrolidine-1-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 55495913 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(oxolan-2-ylmethyl)-5-(2-phenylpyrrolidine-1-carbonyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(=O)N3CCCC3c3ccccc3)cc2C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C24H24N2O4/c27-22(25-12-4-9-21(25)16-6-2-1-3-7-16)17-10-11-19-20(14-17)24(29)26(23(19)28)15-18-8-5-13-30-18/h1-3,6-7,10-11,14,18,21H,4-5,8-9,12-13,15H2 |
| InChIKey | QAOLFFIUHOBZTQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|