C24H20N2O8 — CID 272868
Dimethyl 2,5-bis(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)hexanedioate (PubChem CID 272868) has the molecular formula C24H20N2O8 and a molecular weight of 464.40 g/mol. Its IUPAC name is dimethyl 2,5-bis(1,3-dioxoisoindol-2-yl)hexanedioate.
| Compound Name | Dimethyl 2,5-bis(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)hexanedioate |
|---|---|
| PubChem CID | 272868 |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | dimethyl 2,5-bis(1,3-dioxoisoindol-2-yl)hexanedioate |
| SMILES | COC(=O)C(CCC(C(=O)OC)N1C(=O)C2=CC=CC=C2C1=O)N3C(=O)C4=CC=CC=C4C3=O |
| InChI | InChI=1S/C24H20N2O8/c1-33-23(31)17(25-19(27)13-7-3-4-8-14(13)20(25)28)11-12-18(24(32)34-2)26-21(29)15-9-5-6-10-16(15)22(26)30/h3-10,17-18H,11-12H2,1-2H3 |
| InChIKey | WCLYVNPYCVTHFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 127.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | 781 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|