C22H30ClN3O4 — CID 119645239
5-[4-(ethylaminomethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride (PubChem CID 119645239) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is 5-[4-(ethylaminomethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 5-[4-(ethylaminomethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119645239 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 5-[4-(ethylaminomethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)CC1.Cl |
| InChI | InChI=1S/C22H29N3O4.ClH/c1-2-23-13-15-7-9-24(10-8-15)20(26)16-5-6-18-19(12-16)22(28)25(21(18)27)14-17-4-3-11-29-17;/h5-6,12,15,17,23H,2-4,7-11,13-14H2,1H3;1H |
| InChIKey | MRRQBILJAJTQIB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|