C21H28ClN3O4 — CID 119517781
5-[4-(1-aminoethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride (PubChem CID 119517781) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is 5-[4-(1-aminoethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 5-[4-(1-aminoethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119517781 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 5-[4-(1-aminoethyl)piperidine-1-carbonyl]-2-(oxolan-2-ylmethyl)isoindole-1,3-dione;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)c2ccc3c(c2)C(=O)N(CC2CCCO2)C3=O)CC1.Cl |
| InChI | InChI=1S/C21H27N3O4.ClH/c1-13(22)14-6-8-23(9-7-14)19(25)15-4-5-17-18(11-15)21(27)24(20(17)26)12-16-3-2-10-28-16;/h4-5,11,13-14,16H,2-3,6-10,12,22H2,1H3;1H |
| InChIKey | QODCZHTXPLDLRA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|