C20H22N2O6 — CID 120678142
cis-(1R,3S)-3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120678142) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120678142 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | cis-(1R,3S)-3-[[1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carbonyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(N[C@H]1CC[C@@H](C(=O)O)C1)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O |
| InChI | InChI=1S/C20H22N2O6/c23-17(21-13-5-3-12(8-13)20(26)27)11-4-6-15-16(9-11)19(25)22(18(15)24)10-14-2-1-7-28-14/h4,6,9,12-14H,1-3,5,7-8,10H2,(H,21,23)(H,26,27)/t12-,13+,14?/m1/s1 |
| InChIKey | NJHKOJUEQYSJGN-AMIUJLCOSA-N |
| XLogP | 1.44 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|