C21H11N3O9 — CID 5115325
4-[5-(2,4-dinitrophenoxy)-1,3-dioxoisoindol-2-yl]benzoic acid (PubChem CID 5115325) has the molecular formula C21H11N3O9 and a molecular weight of 449.33 g/mol. Its IUPAC name is 4-[5-(2,4-dinitrophenoxy)-1,3-dioxoisoindol-2-yl]benzoic acid.
| Compound Name | 4-[5-(2,4-dinitrophenoxy)-1,3-dioxoisoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 5115325 |
| Molecular Formula | C21H11N3O9 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 4-[5-(2,4-dinitrophenoxy)-1,3-dioxoisoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C21H11N3O9/c25-19-15-7-6-14(33-18-8-5-13(23(29)30)9-17(18)24(31)32)10-16(15)20(26)22(19)12-3-1-11(2-4-12)21(27)28/h1-10H,(H,27,28) |
| InChIKey | NRTXKDBTMLYKTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|