C23H13NO8S-2 — CID 2262954
3-[5-(4-carboxylatophenyl)sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylbenzoate (PubChem CID 2262954) has the molecular formula C23H13NO8S-2 and a molecular weight of 463.42 g/mol. Its IUPAC name is 3-[5-(4-carboxylatophenyl)sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylbenzoate.
| Compound Name | 3-[5-(4-carboxylatophenyl)sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 2262954 |
| Molecular Formula | C23H13NO8S-2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 3-[5-(4-carboxylatophenyl)sulfonyl-1,3-dioxoisoindol-2-yl]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1N1C(=O)c2ccc(S(=O)(=O)c3ccc(C(=O)[O-])cc3)cc2C1=O |
| InChI | InChI=1S/C23H15NO8S/c1-12-2-3-14(23(29)30)10-19(12)24-20(25)17-9-8-16(11-18(17)21(24)26)33(31,32)15-6-4-13(5-7-15)22(27)28/h2-11H,1H3,(H,27,28)(H,29,30)/p-2 |
| InChIKey | PFVAWNLYXCMZJK-UHFFFAOYSA-L |
| XLogP | 0.36 |
| TPSA | 151.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|