C23H15N2O7S- — CID 6982340
4-[2-[(4-methylbenzoyl)amino]-1,3-dioxoisoindol-5-yl]sulfonylbenzoate (PubChem CID 6982340) has the molecular formula C23H15N2O7S- and a molecular weight of 463.45 g/mol. Its IUPAC name is 4-[2-[(4-methylbenzoyl)amino]-1,3-dioxoisoindol-5-yl]sulfonylbenzoate.
| Compound Name | 4-[2-[(4-methylbenzoyl)amino]-1,3-dioxoisoindol-5-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 6982340 |
| Molecular Formula | C23H15N2O7S- |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 4-[2-[(4-methylbenzoyl)amino]-1,3-dioxoisoindol-5-yl]sulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)NN2C(=O)c3ccc(S(=O)(=O)c4ccc(C(=O)[O-])cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H16N2O7S/c1-13-2-4-14(5-3-13)20(26)24-25-21(27)18-11-10-17(12-19(18)22(25)28)33(31,32)16-8-6-15(7-9-16)23(29)30/h2-12H,1H3,(H,24,26)(H,29,30)/p-1 |
| InChIKey | BGXSEZOINLYVOH-UHFFFAOYSA-M |
| XLogP | 1.13 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|