C15H8BrClN2O3 — CID 4548391
N-(5-bromo-1,3-dioxoisoindol-2-yl)-4-chlorobenzamide (PubChem CID 4548391) has the molecular formula C15H8BrClN2O3 and a molecular weight of 379.60 g/mol. Its IUPAC name is N-(5-bromo-1,3-dioxoisoindol-2-yl)-4-chlorobenzamide.
| Compound Name | N-(5-bromo-1,3-dioxoisoindol-2-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 4548391 |
| Molecular Formula | C15H8BrClN2O3 |
| Molecular Weight | 379.60 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | N-(5-bromo-1,3-dioxoisoindol-2-yl)-4-chlorobenzamide |
| SMILES | O=C(NN1C(=O)c2ccc(Br)cc2C1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H8BrClN2O3/c16-9-3-6-11-12(7-9)15(22)19(14(11)21)18-13(20)8-1-4-10(17)5-2-8/h1-7H,(H,18,20) |
| InChIKey | AULKDOQEWZTWLM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|