C18H13BrClN3O4 — CID 27605076
N'-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-3-chlorobenzohydrazide (PubChem CID 27605076) has the molecular formula C18H13BrClN3O4 and a molecular weight of 450.68 g/mol. Its IUPAC name is N'-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-3-chlorobenzohydrazide.
| Compound Name | N'-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 27605076 |
| Molecular Formula | C18H13BrClN3O4 |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 448.98 |
| IUPAC Name | N'-[3-(5-bromo-1,3-dioxoisoindol-2-yl)propanoyl]-3-chlorobenzohydrazide |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13BrClN3O4/c19-11-4-5-13-14(9-11)18(27)23(17(13)26)7-6-15(24)21-22-16(25)10-2-1-3-12(20)8-10/h1-5,8-9H,6-7H2,(H,21,24)(H,22,25) |
| InChIKey | CEVGIIARBKXFDU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|