C19H16BrClN2O4 — CID 112818214
2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]propanamide (PubChem CID 112818214) has the molecular formula C19H16BrClN2O4 and a molecular weight of 451.70 g/mol. Its IUPAC name is 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]propanamide.
| Compound Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]propanamide |
|---|---|
| PubChem CID | 112818214 |
| Molecular Formula | C19H16BrClN2O4 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[2-(4-chlorophenyl)-2-hydroxyethyl]propanamide |
| SMILES | CC(C(=O)NCC(O)c1ccc(Cl)cc1)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H16BrClN2O4/c1-10(17(25)22-9-16(24)11-2-5-13(21)6-3-11)23-18(26)14-7-4-12(20)8-15(14)19(23)27/h2-8,10,16,24H,9H2,1H3,(H,22,25) |
| InChIKey | WCGDRHLXUNFAIH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|