C19H24BrN3O3 — CID 112809978
2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 112809978) has the molecular formula C19H24BrN3O3 and a molecular weight of 422.32 g/mol. Its IUPAC name is 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 112809978 |
| Molecular Formula | C19H24BrN3O3 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | CC(C(=O)NCCCN1CCCCC1)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C19H24BrN3O3/c1-13(17(24)21-8-5-11-22-9-3-2-4-10-22)23-18(25)15-7-6-14(20)12-16(15)19(23)26/h6-7,12-13H,2-5,8-11H2,1H3,(H,21,24) |
| InChIKey | XQGMPSWWFXLCNC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|