C21H13N2O6S- — CID 5078255
4-[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]sulfonylbenzoate (PubChem CID 5078255) has the molecular formula C21H13N2O6S- and a molecular weight of 421.41 g/mol. Its IUPAC name is 4-[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]sulfonylbenzoate.
| Compound Name | 4-[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 5078255 |
| Molecular Formula | C21H13N2O6S- |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 4-[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]sulfonylbenzoate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)c2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)cc1 |
| InChI | InChI=1S/C21H14N2O6S/c24-19-17-8-7-16(30(28,29)15-5-3-14(4-6-15)21(26)27)10-18(17)20(25)23(19)12-13-2-1-9-22-11-13/h1-11H,12H2,(H,26,27)/p-1 |
| InChIKey | VBJWCIUIMUOSNN-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 124.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|