C26H17NO7S — CID 67886506
5-hydroxy-2-[3-[4-(4-hydroxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione (PubChem CID 67886506) has the molecular formula C26H17NO7S and a molecular weight of 487.49 g/mol. Its IUPAC name is 5-hydroxy-2-[3-[4-(4-hydroxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione.
| Compound Name | 5-hydroxy-2-[3-[4-(4-hydroxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67886506 |
| Molecular Formula | C26H17NO7S |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 5-hydroxy-2-[3-[4-(4-hydroxyphenyl)sulfonylphenoxy]phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(O)cc2C(=O)N1c1cccc(Oc2ccc(S(=O)(=O)c3ccc(O)cc3)cc2)c1 |
| InChI | InChI=1S/C26H17NO7S/c28-17-4-9-21(10-5-17)35(32,33)22-11-7-19(8-12-22)34-20-3-1-2-16(14-20)27-25(30)23-13-6-18(29)15-24(23)26(27)31/h1-15,28-29H |
| InChIKey | YGIWQVAYMCVNHV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|