C24H12N2O11S — CID 25233513
2-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-sulfophenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 25233513) has the molecular formula C24H12N2O11S and a molecular weight of 536.43 g/mol. Its IUPAC name is 2-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-sulfophenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-sulfophenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 25233513 |
| Molecular Formula | C24H12N2O11S |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)-3-sulfophenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(N3C(=O)c4ccc(C(=O)O)cc4C3=O)c(S(=O)(=O)O)c1)C2=O |
| InChI | InChI=1S/C24H12N2O11S/c27-19-13-4-1-10(23(31)32)7-15(13)21(29)25(19)12-3-6-17(18(9-12)38(35,36)37)26-20(28)14-5-2-11(24(33)34)8-16(14)22(26)30/h1-9H,(H,31,32)(H,33,34)(H,35,36,37) |
| InChIKey | NYIRASDIDHMCBO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 203.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|