C21H12Cl2N2O6S — CID 4075586
2-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 4075586) has the molecular formula C21H12Cl2N2O6S and a molecular weight of 491.31 g/mol. Its IUPAC name is 2-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 4075586 |
| Molecular Formula | C21H12Cl2N2O6S |
| Molecular Weight | 491.31 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2-[4-chloro-3-[(4-chlorophenyl)sulfamoyl]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)c(S(=O)(=O)Nc3ccc(Cl)cc3)c1)C2=O |
| InChI | InChI=1S/C21H12Cl2N2O6S/c22-12-2-4-13(5-3-12)24-32(30,31)18-10-14(6-8-17(18)23)25-19(26)15-7-1-11(21(28)29)9-16(15)20(25)27/h1-10,24H,(H,28,29) |
| InChIKey | ADEFVMFWPLGBQT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|