C29H12Cl6N2O6 — CID 167377039
2-[3-chloro-4-[(2,6-dichlorobenzoyl)-(2,4,6-trichlorobenzoyl)amino]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 167377039) has the molecular formula C29H12Cl6N2O6 and a molecular weight of 697.14 g/mol. Its IUPAC name is 2-[3-chloro-4-[(2,6-dichlorobenzoyl)-(2,4,6-trichlorobenzoyl)amino]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[3-chloro-4-[(2,6-dichlorobenzoyl)-(2,4,6-trichlorobenzoyl)amino]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 167377039 |
| Molecular Formula | C29H12Cl6N2O6 |
| Molecular Weight | 697.14 g/mol |
| Exact Mass | 693.88 |
| IUPAC Name | 2-[3-chloro-4-[(2,6-dichlorobenzoyl)-(2,4,6-trichlorobenzoyl)amino]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(N(C(=O)c3c(Cl)cccc3Cl)C(=O)c3c(Cl)cc(Cl)cc3Cl)c(Cl)c1)C2=O |
| InChI | InChI=1S/C29H12Cl6N2O6/c30-13-9-20(34)24(21(35)10-13)28(41)37(27(40)23-17(31)2-1-3-18(23)32)22-7-5-14(11-19(22)33)36-25(38)15-6-4-12(29(42)43)8-16(15)26(36)39/h1-11H,(H,42,43) |
| InChIKey | SSGSVALFXKJROO-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.14 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|