C20H14N2O4S — CID 110352274
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzenesulfonamide (PubChem CID 110352274) has the molecular formula C20H14N2O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110352274 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H14N2O4S/c23-19-17-11-4-5-12-18(17)20(24)22(19)15-8-6-7-14(13-15)21-27(25,26)16-9-2-1-3-10-16/h1-13,21H |
| InChIKey | FDIPHAANWOYJPM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|