C20H13ClN2O4S — CID 91937827
N-(3-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 91937827) has the molecular formula C20H13ClN2O4S and a molecular weight of 412.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 91937827 |
| Molecular Formula | C20H13ClN2O4S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | N-(3-chlorophenyl)-4-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(S(=O)(=O)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H13ClN2O4S/c21-13-4-3-5-14(12-13)22-28(26,27)16-10-8-15(9-11-16)23-19(24)17-6-1-2-7-18(17)20(23)25/h1-12,22H |
| InChIKey | NEIMGUMPOQWCKI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|