C21H19ClN2O4S — CID 25048658
N-(3-chlorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25048658) has the molecular formula C21H19ClN2O4S and a molecular weight of 430.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | N-(3-chlorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25048658 |
| Molecular Formula | C21H19ClN2O4S |
| Molecular Weight | 430.91 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | N-(3-chlorophenyl)-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCCC2)=C(S(=O)(=O)Nc2cccc(Cl)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H19ClN2O4S/c22-14-7-6-8-15(13-14)23-29(27,28)21-18(24-11-4-1-5-12-24)19(25)16-9-2-3-10-17(16)20(21)26/h2-3,6-10,13,23H,1,4-5,11-12H2 |
| InChIKey | IGGSMMDIRJAKEN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|