C19H22N2O4S — CID 25043022
N-cyclopentyl-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25043022) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-cyclopentyl-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | N-cyclopentyl-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25043022 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-cyclopentyl-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCC2)=C(S(=O)(=O)NC2CCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H22N2O4S/c22-17-14-9-3-4-10-15(14)18(23)19(16(17)21-11-5-6-12-21)26(24,25)20-13-7-1-2-8-13/h3-4,9-10,13,20H,1-2,5-8,11-12H2 |
| InChIKey | IGRYWIYIECSHNG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|