C19H24N2O4S — CID 25048727
N-butan-2-yl-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25048727) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-butan-2-yl-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | N-butan-2-yl-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25048727 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-butan-2-yl-1,4-dioxo-3-piperidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)C1=C(N2CCCCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H24N2O4S/c1-3-13(2)20-26(24,25)19-16(21-11-7-4-8-12-21)17(22)14-9-5-6-10-15(14)18(19)23/h5-6,9-10,13,20H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | VKUJLNZHYGOGEV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|