C21H20N2O4S — CID 25037207
N-(4-methylphenyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25037207) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-(4-methylphenyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | N-(4-methylphenyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25037207 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-(4-methylphenyl)-1,4-dioxo-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)C2=C(N3CCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-14-8-10-15(11-9-14)22-28(26,27)21-18(23-12-4-5-13-23)19(24)16-6-2-3-7-17(16)20(21)25/h2-3,6-11,22H,4-5,12-13H2,1H3 |
| InChIKey | BSKLQIZTWXHWII-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|