C26H22N2O5S — CID 25036232
1,4-dioxo-N-(4-phenoxyphenyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide (PubChem CID 25036232) has the molecular formula C26H22N2O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is 1,4-dioxo-N-(4-phenoxyphenyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide.
| Compound Name | 1,4-dioxo-N-(4-phenoxyphenyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25036232 |
| Molecular Formula | C26H22N2O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1,4-dioxo-N-(4-phenoxyphenyl)-3-pyrrolidin-1-ylnaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCCC2)=C(S(=O)(=O)Nc2ccc(Oc3ccccc3)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H22N2O5S/c29-24-21-10-4-5-11-22(21)25(30)26(23(24)28-16-6-7-17-28)34(31,32)27-18-12-14-20(15-13-18)33-19-8-2-1-3-9-19/h1-5,8-15,27H,6-7,16-17H2 |
| InChIKey | UWGSBUNNNPLCKD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|