C20H17BrN2O5S — CID 25047036
N-(4-bromophenyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25047036) has the molecular formula C20H17BrN2O5S and a molecular weight of 477.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-(4-bromophenyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25047036 |
| Molecular Formula | C20H17BrN2O5S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | N-(4-bromophenyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCOCC2)=C(S(=O)(=O)Nc2ccc(Br)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H17BrN2O5S/c21-13-5-7-14(8-6-13)22-29(26,27)20-17(23-9-11-28-12-10-23)18(24)15-3-1-2-4-16(15)19(20)25/h1-8,22H,9-12H2 |
| InChIKey | QSGBBEMWEBJUHP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|