C22H20N2O7S — CID 25042699
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25042699) has the molecular formula C22H20N2O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25042699 |
| Molecular Formula | C22H20N2O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCOCC2)=C(S(=O)(=O)Nc2ccc3c(c2)OCCO3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C22H20N2O7S/c25-20-15-3-1-2-4-16(15)21(26)22(19(20)24-7-9-29-10-8-24)32(27,28)23-14-5-6-17-18(13-14)31-12-11-30-17/h1-6,13,23H,7-12H2 |
| InChIKey | BSZYKSHNVUAPRR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|