C22H22N2O6S — CID 25041252
3-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25041252) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | 3-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25041252 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-(diethylamino)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | CCN(CC)C1=C(S(=O)(=O)Nc2ccc3c(c2)OCCO3)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H22N2O6S/c1-3-24(4-2)19-20(25)15-7-5-6-8-16(15)21(26)22(19)31(27,28)23-14-9-10-17-18(13-14)30-12-11-29-17/h5-10,13,23H,3-4,11-12H2,1-2H3 |
| InChIKey | PQNQMFAENMANSY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|