C21H18N2O7S — CID 25035907
N-(1,3-benzodioxol-5-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25035907) has the molecular formula C21H18N2O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25035907 |
| Molecular Formula | C21H18N2O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCOCC2)=C(S(=O)(=O)Nc2ccc3c(c2)OCO3)C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H18N2O7S/c24-19-14-3-1-2-4-15(14)20(25)21(18(19)23-7-9-28-10-8-23)31(26,27)22-13-5-6-16-17(11-13)30-12-29-16/h1-6,11,22H,7-10,12H2 |
| InChIKey | DOYZWCCVPUDYOU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|