C18H22N2O7S — CID 23852518
N,N-bis(2-hydroxyethyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 23852518) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 23852518 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | O=C1C(N2CCOCC2)=C(S(=O)(=O)N(CCO)CCO)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H22N2O7S/c21-9-5-20(6-10-22)28(25,26)18-15(19-7-11-27-12-8-19)16(23)13-3-1-2-4-14(13)17(18)24/h1-4,21-22H,5-12H2 |
| InChIKey | ZGOSCTORYLMABB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|