C18H22N2O6S — CID 25047016
N-(1-methoxypropan-2-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide (PubChem CID 25047016) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide.
| Compound Name | N-(1-methoxypropan-2-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 25047016 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-3-morpholin-4-yl-1,4-dioxonaphthalene-2-sulfonamide |
| SMILES | COCC(C)NS(=O)(=O)C1=C(N2CCOCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H22N2O6S/c1-12(11-25-2)19-27(23,24)18-15(20-7-9-26-10-8-20)16(21)13-5-3-4-6-14(13)17(18)22/h3-6,12,19H,7-11H2,1-2H3 |
| InChIKey | NBMMFAWJCLMQBS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|