C15H15NO4 — CID 781111
2-methoxy-3-morpholin-4-ylnaphthalene-1,4-dione (PubChem CID 781111) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-methoxy-3-morpholin-4-ylnaphthalene-1,4-dione.
| Compound Name | 2-methoxy-3-morpholin-4-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 781111 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-methoxy-3-morpholin-4-ylnaphthalene-1,4-dione |
| SMILES | COC1=C(N2CCOCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO4/c1-19-15-12(16-6-8-20-9-7-16)13(17)10-4-2-3-5-11(10)14(15)18/h2-5H,6-9H2,1H3 |
| InChIKey | WUTXIXPBNDXIEL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|