C20H16ClNO3 — CID 18871168
2-(4-chlorophenyl)-3-morpholin-4-ylnaphthalene-1,4-dione (PubChem CID 18871168) has the molecular formula C20H16ClNO3 and a molecular weight of 353.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-morpholin-4-ylnaphthalene-1,4-dione.
| Compound Name | 2-(4-chlorophenyl)-3-morpholin-4-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 18871168 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-(4-chlorophenyl)-3-morpholin-4-ylnaphthalene-1,4-dione |
| SMILES | O=C1C(c2ccc(Cl)cc2)=C(N2CCOCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H16ClNO3/c21-14-7-5-13(6-8-14)17-18(22-9-11-25-12-10-22)20(24)16-4-2-1-3-15(16)19(17)23/h1-8H,9-12H2 |
| InChIKey | AUQIMEVEXMCKIU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|