C26H32N2O10 — CID 102095398
dimethyl (2S)-2-[acetyl-[1,4-dioxo-3-(1,4,7-trioxa-10-azacyclododec-10-yl)naphthalen-2-yl]amino]butanedioate (PubChem CID 102095398) has the molecular formula C26H32N2O10 and a molecular weight of 532.55 g/mol. Its IUPAC name is dimethyl (2S)-2-[acetyl-[1,4-dioxo-3-(1,4,7-trioxa-10-azacyclododec-10-yl)naphthalen-2-yl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[acetyl-[1,4-dioxo-3-(1,4,7-trioxa-10-azacyclododec-10-yl)naphthalen-2-yl]amino]butanedioate |
|---|---|
| PubChem CID | 102095398 |
| Molecular Formula | C26H32N2O10 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | dimethyl (2S)-2-[acetyl-[1,4-dioxo-3-(1,4,7-trioxa-10-azacyclododec-10-yl)naphthalen-2-yl]amino]butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC)N(C(C)=O)C1=C(N2CCOCCOCCOCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H32N2O10/c1-17(29)28(20(26(33)35-3)16-21(30)34-2)23-22(24(31)18-6-4-5-7-19(18)25(23)32)27-8-10-36-12-14-38-15-13-37-11-9-27/h4-7,20H,8-16H2,1-3H3/t20-/m0/s1 |
| InChIKey | BVGGZTUJKPFIAU-FQEVSTJZSA-N |
| XLogP | 0.60 |
| TPSA | 137.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|