C29H34N2O4 — CID 46499618
N-(4-heptylphenyl)-N-(3-morpholin-4-yl-1,4-dioxonaphthalen-2-yl)acetamide (PubChem CID 46499618) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-(4-heptylphenyl)-N-(3-morpholin-4-yl-1,4-dioxonaphthalen-2-yl)acetamide.
| Compound Name | N-(4-heptylphenyl)-N-(3-morpholin-4-yl-1,4-dioxonaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 46499618 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-(4-heptylphenyl)-N-(3-morpholin-4-yl-1,4-dioxonaphthalen-2-yl)acetamide |
| SMILES | CCCCCCCc1ccc(N(C(C)=O)C2=C(N3CCOCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C29H34N2O4/c1-3-4-5-6-7-10-22-13-15-23(16-14-22)31(21(2)32)27-26(30-17-19-35-20-18-30)28(33)24-11-8-9-12-25(24)29(27)34/h8-9,11-16H,3-7,10,17-20H2,1-2H3 |
| InChIKey | LCSJBMBAAPTJMX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|