methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate

C16H18N2O5 — CID 54490539

IUPACmethyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate
SMILESCOC(=O)C(CN1CCOCC1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C16H18N2O5/c1-22-16(21)13(10-17-6-8-23-9-7-17)18-14(19)11-4-2-3-5-12(11)15(18)20/h2-5,13H,6-10H2,1H3
InChIKeySCLZKUZVDWLBHE-UHFFFAOYSA-N
MW318.33 g/mol
LogP0.16
Rot. Bonds4

About methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate

methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate (PubChem CID 54490539) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate.

Molecular Properties

Compound Namemethyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate
PubChem CID54490539
Molecular FormulaC16H18N2O5
Molecular Weight318.33 g/mol
Exact Mass318.12
IUPAC Namemethyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate
SMILESCOC(=O)C(CN1CCOCC1)N1C(=O)c2ccccc2C1=O
InChIInChI=1S/C16H18N2O5/c1-22-16(21)13(10-17-6-8-23-9-7-17)18-14(19)11-4-2-3-5-12(11)15(18)20/h2-5,13H,6-10H2,1H3
InChIKeySCLZKUZVDWLBHE-UHFFFAOYSA-N
XLogP0.16
TPSA76.15 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.33
LogP ≤ 50.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate?
The IUPAC name of methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate (CID 54490539) is methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate.
What is the SMILES notation for methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate?
The canonical SMILES for methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate is COC(=O)C(CN1CCOCC1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate?
The InChIKey is SCLZKUZVDWLBHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5/c1-22-16(21)13(10-17-6-8-23-9-7-17)18-14(19)11-4-2-3-5-12(11)15(18)20/h2-5,13H,6-10H2,1H3.
What are the key properties of methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate?
methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate has a molecular weight of 318.33 g/mol, XLogP of 0.16, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate is sourced from PubChem (CID 54490539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).