C16H18N2O5 — CID 54490539
methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate (PubChem CID 54490539) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate.
| Compound Name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate |
|---|---|
| PubChem CID | 54490539 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | methyl 2-(1,3-dioxoisoindol-2-yl)-3-morpholin-4-ylpropanoate |
| SMILES | COC(=O)C(CN1CCOCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N2O5/c1-22-16(21)13(10-17-6-8-23-9-7-17)18-14(19)11-4-2-3-5-12(11)15(18)20/h2-5,13H,6-10H2,1H3 |
| InChIKey | SCLZKUZVDWLBHE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|