C24H24N2O4 — CID 2903286
N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 2903286) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2903286 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(N(C(C)=O)C2=C(N3CCCCC3)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C24H24N2O4/c1-16(27)26(17-9-8-10-18(15-17)30-2)22-21(25-13-6-3-7-14-25)23(28)19-11-4-5-12-20(19)24(22)29/h4-5,8-12,15H,3,6-7,13-14H2,1-2H3 |
| InChIKey | SKNISOGASNEFTH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|