C24H24N2O3 — CID 46500539
N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)acetamide (PubChem CID 46500539) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 46500539 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)acetamide |
| SMILES | CC(=O)N(C1=C(N2CCCC2)C(=O)c2ccccc2C1=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-15-12-16(2)14-18(13-15)26(17(3)27)22-21(25-10-6-7-11-25)23(28)19-8-4-5-9-20(19)24(22)29/h4-5,8-9,12-14H,6-7,10-11H2,1-3H3 |
| InChIKey | XWSLKXQCYWPYKL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|